CAS 898778-66-0
:1-(3,5-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(3,5-Difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-66-0, is an organic compound characterized by its complex fluorinated aromatic structure. This compound features a propanone backbone, which is a ketone functional group, indicating the presence of a carbonyl group (C=O) flanked by two aromatic rings that are heavily substituted with fluorine atoms. The presence of multiple fluorine substituents enhances the compound's lipophilicity and may influence its reactivity and biological activity. Typically, such fluorinated compounds exhibit unique properties, including increased stability and altered electronic characteristics, which can be advantageous in pharmaceutical applications. The compound's molecular structure suggests potential uses in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the specific arrangement of the fluorine atoms can affect the compound's interaction with biological targets, making it a subject of interest in drug design and development. Overall, this compound exemplifies the significance of fluorinated organic molecules in modern chemistry and their potential applications in various fields.
Formula:C15H9F5O
InChI:InChI=1/C15H9F5O/c16-10-5-9(6-11(17)7-10)14(21)2-1-8-3-12(18)15(20)13(19)4-8/h3-7H,1-2H2
SMILES:C(CC(=O)c1cc(cc(c1)F)F)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.