CymitQuimica logo

CAS 898778-67-1

:

[5-(1,3-dioxolan-2-yl)-2-thienyl]-(4-pentoxyphenyl)methanone

Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(4-pentoxyphenyl)methanone, with the CAS number 898778-67-1, is a synthetic organic compound characterized by its complex structure, which includes a thienyl group, a dioxolane ring, and a pentoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential stability and reactivity due to the presence of functional groups. The dioxolane ring contributes to its potential solubility in polar solvents, while the thienyl and phenyl groups may enhance its electronic properties, making it of interest in various applications, including organic electronics and pharmaceuticals. Additionally, the presence of the methanone functional group suggests potential reactivity in nucleophilic addition reactions. Overall, this compound's unique structural features may impart specific biological or chemical activities, warranting further investigation for potential applications in material science or medicinal chemistry.
Formula:C19H22O4S
InChI:InChI=1/C19H22O4S/c1-2-3-4-11-21-15-7-5-14(6-8-15)18(20)16-9-10-17(24-16)19-22-12-13-23-19/h5-10,19H,2-4,11-13H2,1H3
SMILES:CCCCCOc1ccc(cc1)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.