CAS 898778-70-6
:1-(2,6-dichlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(2,6-Dichlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-70-6, is an organic compound characterized by its complex structure featuring both dichlorophenyl and trifluorophenyl groups. This compound typically exhibits a solid state at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the halogen substituents. The presence of chlorine and fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. The compound's ketone functional group contributes to its chemical reactivity, allowing for various transformations in synthetic chemistry. Additionally, its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as with many halogenated compounds, due to potential toxicity and environmental concerns. Overall, this compound represents a significant interest in research fields focused on drug development and material science.
Formula:C15H9Cl2F3O
InChI:InChI=1/C15H9Cl2F3O/c16-9-2-1-3-10(17)14(9)13(21)5-4-8-6-11(18)15(20)12(19)7-8/h1-3,6-7H,4-5H2
SMILES:c1cc(c(c(c1)Cl)C(=O)CCc1cc(c(c(c1)F)F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.