CAS 898778-71-7

[5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(heptyloxy)phenyl]methanone

Description:

The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(heptyloxy)phenyl]methanone, with the CAS number 898778-71-7, is a synthetic organic compound characterized by its complex structure, which includes a thienyl group, a dioxolane ring, and a heptyloxy-substituted phenyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in organic electronics, pharmaceuticals, or as a dye. The presence of the dioxolane ring suggests potential for solubility in polar solvents, while the heptyloxy chain may enhance hydrophobic interactions. Additionally, the thienyl group can impart unique electronic properties, making it of interest in materials science. The compound's stability, reactivity, and specific interactions would depend on its molecular conformation and the environment in which it is used. Overall, this substance represents a versatile scaffold for further chemical modifications and applications in various fields of chemistry.

Formula: C₂₁H₂₆O₄S

InChI: InChI=1S/C21H26O4S/c1-2-3-4-5-6-13-23-17-9-7-16(8-10-17)20(22)18-11-12-19(26-18)21-24-14-15-25-21/h7-12,21H,2-6,13-15H2,1H3

InChI key: InChIKey=TWOIVXBNIUADIG-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(OCCCCCCC)C=C3

Synonyms:

• Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl][4-(heptyloxy)phenyl]-
• [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(heptyloxy)phenyl]methanone