CAS 898778-72-8

1-cyclopropyl-3-(3,4,5-trifluorophenyl)propan-1-one

Description:

1-Cyclopropyl-3-(3,4,5-trifluorophenyl)propan-1-one is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a trifluorophenyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The cyclopropyl ring introduces strain, which can lead to interesting chemical behavior, including increased reactivity in certain reactions. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-cyclopropyl-3-(3,4,5-trifluorophenyl)propan-1-one represents a versatile compound with potential utility in various chemical applications.

Formula: C₁₂H₁₁F₃O

InChI: InChI=1/C12H11F3O/c13-9-5-7(6-10(14)12(9)15)1-4-11(16)8-2-3-8/h5-6,8H,1-4H2

SMILES: C(CC(=O)C1CC1)c1cc(c(c(c1)F)F)F