CAS 898778-73-9

(2,3-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(2,3-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group, a dioxolane ring, and a thienyl moiety. The presence of fluorine atoms in the phenyl ring enhances its electronic properties, potentially increasing lipophilicity and influencing biological activity. The dioxolane ring contributes to the compound's stability and may participate in various chemical reactions due to its ether-like characteristics. The thienyl group, derived from thiophene, introduces sulfur into the structure, which can affect the compound's reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique combination of functional groups suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its toxicity, solubility, and pharmacokinetics would be necessary to fully understand its behavior in biological systems.

Formula: C₁₄H₁₀F₂O₃S

InChI: InChI=1S/C14H10F2O3S/c15-9-3-1-2-8(12(9)16)13(17)10-4-5-11(20-10)14-18-6-7-19-14/h1-5,14H,6-7H2

InChI key: InChIKey=STJYDFNWJKQGGI-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=C(F)C(F)=CC=C3

Synonyms:

• (2,3-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
• Methanone, (2,3-difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-

2-(2,3-Difluorobenzoyl)-5-(1,3-dioxolan-2-yl)thiophene

CAS: 898778-73-9

Formula: C₁₄H₁₀F₂O₃S

Purity: 97.0%

Molecular weight: 296.29

Ref: 10-F202459