CymitQuimica logo

CAS 898778-75-1

:

1-Cyclopentyl-3-(3,4,5-trifluorophenyl)-1-propanone

Description:
1-Cyclopentyl-3-(3,4,5-trifluorophenyl)-1-propanone, with the CAS number 898778-75-1, is an organic compound characterized by its unique structure that includes a cyclopentyl group and a trifluorophenyl moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic cyclopentyl and trifluorophenyl groups. The presence of trifluoromethyl groups can impart significant electronic effects, influencing the compound's reactivity and potential applications in medicinal chemistry or material science. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in drug development or as a chemical intermediate. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C14H15F3O
InChI:InChI=1S/C14H15F3O/c15-11-7-9(8-12(16)14(11)17)5-6-13(18)10-3-1-2-4-10/h7-8,10H,1-6H2
InChI key:InChIKey=ZTYPCNRZYPDOCN-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCCC1)C2=CC(F)=C(F)C(F)=C2
Synonyms:
  • 1-Cyclopentyl-3-(3,4,5-trifluorophenyl)-1-propanone
  • 1-Propanone, 1-cyclopentyl-3-(3,4,5-trifluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.