CymitQuimica logo

CAS 898778-76-2

:

(2,4-difluorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:
(2,4-Difluorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-76-2, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenyl group may enhance lipophilicity and influence biological activity, while the dioxolane ring can contribute to its solubility and reactivity in various chemical environments. The thienyl component adds to the compound's electronic properties, potentially making it useful in applications such as pharmaceuticals or agrochemicals. Its unique structure suggests potential for specific interactions in biological systems, which may be explored in drug development or material science. As with many synthetic compounds, safety and handling precautions should be observed, and its environmental impact should be assessed in accordance with regulatory guidelines.
Formula:C14H10F2O3S
InChI:InChI=1/C14H10F2O3S/c15-8-1-2-9(10(16)7-8)13(17)11-3-4-12(20-11)14-18-5-6-19-14/h1-4,7,14H,5-6H2
SMILES:c1cc(c(cc1F)F)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.