CAS 898778-78-4

(2,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(2,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone is a synthetic organic compound characterized by its complex molecular structure, which includes a difluorophenyl group, a thienyl moiety, and a dioxolane ring. The presence of fluorine atoms enhances its electronic properties, potentially increasing its reactivity and lipophilicity. The dioxolane ring contributes to the compound's stability and may influence its solubility in various solvents. This compound is likely to exhibit interesting biological activity due to its unique structural features, making it a candidate for pharmaceutical applications. Its synthesis typically involves multi-step organic reactions, which may include halogenation, coupling reactions, and ring formation. The compound's properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, (2,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone represents a class of compounds that may have significant implications in medicinal chemistry and material science.

Formula: C₁₄H₁₀F₂O₃S

InChI: InChI=1S/C14H10F2O3S/c15-8-1-2-10(16)9(7-8)13(17)11-3-4-12(20-11)14-18-5-6-19-14/h1-4,7,14H,5-6H2

InChI key: InChIKey=DWRJPKCOJJNVBM-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=C(F)C=CC(F)=C3

Synonyms:

• (2,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
• Methanone, (2,5-difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-

2-(2,5-Difluorobenzoyl)-5-(1,3-dioxolan-2-yl)thiophene

CAS: 898778-78-4

Formula: C₁₄H₁₀F₂O₃S

Purity: 97.0%

Molecular weight: 296.29

Ref: 10-F202461