CAS 898778-80-8

(2,6-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(2,6-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-80-8, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing fluorine atoms. The dioxolane ring contributes to its solubility in polar solvents, while the thienyl group may impart additional electronic properties, influencing its reactivity and interaction with biological targets. The presence of multiple functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its unique structure may also allow for specific interactions in biological systems, making it a candidate for further research in drug design and development. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, with implications for various fields including materials science and biochemistry.

Formula: C₁₄H₁₀F₂O₃S

InChI: InChI=1S/C14H10F2O3S/c15-8-2-1-3-9(16)12(8)13(17)10-4-5-11(20-10)14-18-6-7-19-14/h1-5,14H,6-7H2

InChI key: InChIKey=KFONNASZCADLPH-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC=C1F)C=2SC(=CC2)C3OCCO3

Synonyms:

• Methanone, (2,6-difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• (2,6-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

2-(2,6-Difluorobenzoyl)-5-(1,3-dioxolan-2-yl)thiophene

CAS: 898778-80-8

Formula: C₁₄H₁₀F₂O₃S

Purity: 97.0%

Molecular weight: 296.29

Ref: 10-F202462