CymitQuimica logo

CAS 898778-81-9

:

[3-(1,3-dioxolan-2-yl)phenyl]-(o-tolyl)methanone

Description:
The chemical substance known as [3-(1,3-dioxolan-2-yl)phenyl]-(o-tolyl)methanone, with the CAS number 898778-81-9, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a dioxolane moiety and an o-tolyl group. This compound typically exhibits properties associated with ketones, such as being a potential electrophile due to the carbonyl group. The presence of the dioxolane ring suggests it may have interesting solubility characteristics and could participate in various chemical reactions, including nucleophilic attacks. Additionally, the aromatic rings contribute to its stability and may influence its reactivity and interaction with other molecules. The compound may also exhibit specific biological activities, making it of interest in medicinal chemistry. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research and characterization. Overall, this compound represents a unique structure that could have diverse implications in chemical and biological contexts.
Formula:C17H16O3
InChI:InChI=1/C17H16O3/c1-12-5-2-3-8-15(12)16(18)13-6-4-7-14(11-13)17-19-9-10-20-17/h2-8,11,17H,9-10H2,1H3
SMILES:Cc1ccccc1C(=O)c1cccc(c1)C1OCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.