CymitQuimica logo

CAS 898778-82-0

:

(3,4-difluorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:
(3,4-Difluorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with two fluorine atoms and a thienyl group linked to a dioxolane moiety. The presence of fluorine atoms typically enhances the compound's lipophilicity and may influence its biological activity. The dioxolane ring contributes to the compound's stability and can participate in various chemical reactions, while the thienyl group adds to the overall reactivity and potential interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. Overall, this compound represents a valuable addition to the library of fluorinated organic molecules with potential therapeutic applications.
Formula:C14H10F2O3S
InChI:InChI=1/C14H10F2O3S/c15-9-2-1-8(7-10(9)16)13(17)11-3-4-12(20-11)14-18-5-6-19-14/h1-4,7,14H,5-6H2
SMILES:c1cc(c(cc1C(=O)c1ccc(C2OCCO2)s1)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.