CAS 898778-84-2

(3,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(3,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with CAS number 898778-84-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with fluorine atoms and a thienyl moiety linked to a dioxolane group. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its biological activity. The dioxolane ring contributes to the compound's stability and may affect its solubility in various solvents. This compound is likely to exhibit interesting chemical reactivity due to the presence of functional groups that can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. However, detailed studies would be necessary to fully understand its properties, including its reactivity, stability, and potential applications in various fields.

Formula: C₁₄H₁₀F₂O₃S

InChI: InChI=1S/C14H10F2O3S/c15-9-5-8(6-10(16)7-9)13(17)11-1-2-12(20-11)14-18-3-4-19-14/h1-2,5-7,14H,3-4H2

InChI key: InChIKey=KGMZFPLDFYSLAW-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC(F)=CC(F)=C3

Synonyms:

• Methanone, (3,5-difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• (3,5-Difluorophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone