CymitQuimica logo

CAS 898778-86-4

:

(2,3-dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:
(2,3-Dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-86-4, is a synthetic organic compound characterized by its complex structure that includes a dichlorophenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. The presence of chlorine atoms in the phenyl ring can enhance its electrophilic character, making it potentially useful in various chemical reactions. The dioxolane ring contributes to its stability and solubility in organic solvents. Additionally, the thienyl group may impart unique electronic properties, making this compound of interest in fields such as medicinal chemistry and materials science. Its specific applications would depend on further studies into its biological activity and chemical behavior, which could reveal potential uses in pharmaceuticals or agrochemicals. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H10Cl2O3S
InChI:InChI=1/C14H10Cl2O3S/c15-9-3-1-2-8(12(9)16)13(17)10-4-5-11(20-10)14-18-6-7-19-14/h1-5,14H,6-7H2
SMILES:c1cc(c(c(c1)Cl)Cl)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.