CAS 898778-87-5

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](2-methoxyphenyl)-

Description:

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](2-methoxyphenyl)-, with the CAS number 898778-87-5, is an organic compound characterized by its complex structure that includes a methanone functional group and two aromatic rings. The presence of a 1,3-dioxolane moiety suggests it has a cyclic ether component, which can influence its reactivity and solubility. This compound is likely to exhibit properties typical of ketones, such as being a polar substance, which may enhance its interactions with other polar solvents. The methoxy group on one of the phenyl rings can contribute to its electron-donating characteristics, potentially affecting its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of multiple functional groups may allow for diverse chemical behavior, including potential applications in organic synthesis or as intermediates in pharmaceutical development. Overall, the unique combination of functional groups in this compound suggests it may have interesting chemical properties and potential applications in various fields of chemistry.

Formula: C₁₇H₁₆O₄

InChI: InChI=1/C17H16O4/c1-19-15-8-3-2-7-14(15)16(18)12-5-4-6-13(11-12)17-20-9-10-21-17/h2-8,11,17H,9-10H2,1H3

InChI key: InChIKey=OWBKUDRTWXUVDC-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)C2=CC(=CC=C2)C3OCCO3

Synonyms:

• Methanone, [3-(1,3-dioxolan-2-yl)phenyl](2-methoxyphenyl)-
• 3′-(1,3-Dioxolan-2-yl)-2-methoxybenzophenone
• [3-(1,3-Dioxolan-2-yl)phenyl](2-methoxyphenyl)methanone

3'-(1,3-Dioxolan-2-yl)-2-methoxybenzophenone

CAS: 898778-87-5

Purity: 97.0%

Molecular weight: 284.3110046386719

Ref: 10-F206796