CAS 898778-91-1

[3-(1,3-dioxolan-2-yl)phenyl]-(4-methoxyphenyl)methanone

Description:

The chemical substance known as [3-(1,3-dioxolan-2-yl)phenyl]-(4-methoxyphenyl)methanone, with the CAS number 898778-91-1, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a methoxy group and a dioxolane moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high stability under standard conditions and potential reactivity in electrophilic aromatic substitution reactions. The presence of the dioxolane ring suggests it may participate in reactions typical of cyclic ethers, including ring-opening reactions under acidic or basic conditions. Additionally, the methoxy group can influence the compound's solubility and polarity, making it more hydrophilic compared to unsubstituted phenyl ketones. This compound may have applications in organic synthesis, pharmaceuticals, or materials science, depending on its specific reactivity and functional properties. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₇H₁₆O₄

InChI: InChI=1/C17H16O4/c1-19-15-7-5-12(6-8-15)16(18)13-3-2-4-14(11-13)17-20-9-10-21-17/h2-8,11,17H,9-10H2,1H3

SMILES: COc1ccc(cc1)C(=O)c1cccc(c1)C1OCCO1