CAS 898778-92-2

(2,6-dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(2,6-Dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-92-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a dichlorophenyl group and a thienyl moiety linked through a methanone functional group. This compound features a dioxolane ring, contributing to its potential reactivity and solubility properties. The presence of chlorine atoms in the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The thienyl group can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Overall, this compound's unique structural features suggest it may exhibit interesting chemical behavior and biological activity, warranting further investigation in medicinal chemistry and related fields.

Formula: C₁₄H₁₀Cl₂O₃S

InChI: InChI=1/C14H10Cl2O3S/c15-8-2-1-3-9(16)12(8)13(17)10-4-5-11(20-10)14-18-6-7-19-14/h1-5,14H,6-7H2

SMILES: c1cc(c(c(c1)Cl)C(=O)c1ccc(C2OCCO2)s1)Cl

2-(2,6-Dichlorobenzoyl)-5-(1,3-dioxolan-2-yl)thiophene

CAS: 898778-92-2

Purity: 97.0%

Molecular weight: 329.19000244140625

Ref: 10-F202468