CymitQuimica logo

CAS 898778-96-6

:

(3,5-dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:
(3,5-Dichlorophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-96-6, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential reactivity and biological activity. The presence of the dichlorophenyl group suggests enhanced lipophilicity, which may influence its solubility and interaction with biological membranes. The dioxolane ring can provide stability and may participate in various chemical reactions, while the thienyl component can contribute to electronic properties and potential pharmacological effects. Such compounds are often studied for their applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Overall, the unique combination of functional groups in this compound may lead to interesting chemical behavior and potential utility in various fields, including drug development and material science.
Formula:C14H10Cl2O3S
InChI:InChI=1/C14H10Cl2O3S/c15-9-5-8(6-10(16)7-9)13(17)11-1-2-12(20-11)14-18-3-4-19-14/h1-2,5-7,14H,3-4H2
SMILES:c1cc(C2OCCO2)sc1C(=O)c1cc(cc(c1)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.