CAS 898779-00-5

ethyl 2-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate

Description:

Ethyl 2-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate, identified by its CAS number 898779-00-5, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a benzoate moiety, which is derived from benzoic acid, and incorporates a dioxolane ring, contributing to its unique chemical properties. The presence of the dioxolane ring suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. Ethyl 2-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate may exhibit moderate solubility in organic solvents, while its stability and reactivity can be influenced by the substituents on the aromatic rings. Additionally, the compound's structure may impart specific biological activities, making it of interest in pharmaceutical research. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.

Formula: C₁₉H₁₈O₅

InChI: InChI=1/C19H18O5/c1-2-22-18(21)16-9-4-3-8-15(16)17(20)13-6-5-7-14(12-13)19-23-10-11-24-19/h3-9,12,19H,2,10-11H2,1H3

SMILES: CCOC(=O)c1ccccc1C(=O)c1cccc(c1)C1OCCO1