CymitQuimica logo

CAS 898779-04-9

:

(2,5-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:
(2,5-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898779-04-9, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with methoxy groups and a thienyl moiety linked to a dioxolane. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential stability under standard conditions and solubility in organic solvents. The presence of methoxy groups can enhance its lipophilicity and influence its reactivity, while the dioxolane ring may contribute to its overall molecular rigidity and steric effects. Additionally, the thienyl group can impart unique electronic properties, making the compound of interest in various fields, including medicinal chemistry and materials science. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and synthetic modifications. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C16H16O5S
InChI:InChI=1S/C16H16O5S/c1-18-10-3-4-12(19-2)11(9-10)15(17)13-5-6-14(22-13)16-20-7-8-21-16/h3-6,9,16H,7-8H2,1-2H3
InChI key:InChIKey=DADKYNQHWOZMLM-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC(OC)=C1)C=2SC(=CC2)C3OCCO3
Synonyms:
  • Methanone, (2,5-dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-
  • (2,5-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.