CAS 898779-06-1

ethyl 4-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate

Description:

Ethyl 4-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. This compound features a complex structure that includes a benzoyl moiety and a dioxolane ring, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the dioxolane ring suggests that it may exhibit unique chemical reactivity and stability, making it of interest for synthetic chemistry. Ethyl 4-[3-(1,3-dioxolan-2-yl)benzoyl]benzoate may also possess specific solubility characteristics, likely being soluble in organic solvents while having limited solubility in water due to its hydrophobic aromatic components. Its molecular structure may allow for interactions with biological systems, which could be explored for drug development or as a precursor in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₉H₁₈O₅

InChI: InChI=1/C19H18O5/c1-2-22-18(21)14-8-6-13(7-9-14)17(20)15-4-3-5-16(12-15)19-23-10-11-24-19/h3-9,12,19H,2,10-11H2,1H3

SMILES: CCOC(=O)c1ccc(cc1)C(=O)c1cccc(c1)C1OCCO1

4'-carboethoxy-3-(1,3-dioxolan-2-yl)benzophenone

CAS: 898779-06-1

Purity: 97.0%

Molecular weight: 326.3479919433594

Ref: 10-F206804