CAS 898779-07-2

(2,6-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(2,6-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898779-07-2, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with two methoxy groups and a thienyl moiety linked through a dioxolane ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxy groups enhance its solubility in organic solvents and may influence its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry. The dioxolane ring contributes to its potential as a building block in the synthesis of more complex molecules. Additionally, the presence of sulfur in the thienyl group may impart unique chemical reactivity and biological activity. Overall, this compound's structural features suggest it could be of interest in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₆H₁₆O₅S

InChI: InChI=1/C16H16O5S/c1-18-10-4-3-5-11(19-2)14(10)15(17)12-6-7-13(22-12)16-20-8-9-21-16/h3-7,16H,8-9H2,1-2H3

InChI key: InChIKey=RKGBBCPUJWQBRI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1OC)C=2SC(=CC2)C3OCCO3

Synonyms:

• Methanone, (2,6-dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• (2,6-Dimethoxyphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone