CymitQuimica logo

CAS 898779-09-4

:

[3-(1,3-dioxolan-2-yl)phenyl]-(2-methylsulfanylphenyl)methanone

Description:
The chemical substance known as [3-(1,3-dioxolan-2-yl)phenyl]-(2-methylsulfanylphenyl)methanone, with the CAS number 898779-09-4, is characterized by its complex molecular structure that includes a phenyl ring substituted with a dioxolane moiety and a methylsulfanyl group. This compound is likely to exhibit properties typical of organic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carbonyl (ketone) and the dioxolane ring. The dioxolane ring may impart stability and influence the compound's polarity, while the methylsulfanyl group can enhance its reactivity and interaction with other molecules. Additionally, the presence of multiple aromatic systems suggests potential for π-π stacking interactions, which could affect its physical properties and behavior in various chemical environments. Overall, this compound may find applications in fields such as pharmaceuticals or materials science, depending on its specific reactivity and interactions.
Formula:C17H16O3S
InChI:InChI=1/C17H16O3S/c1-21-15-8-3-2-7-14(15)16(18)12-5-4-6-13(11-12)17-19-9-10-20-17/h2-8,11,17H,9-10H2,1H3
SMILES:CSc1ccccc1C(=O)c1cccc(c1)C1OCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.