CAS 898779-14-1
:1-(3-bromophenyl)-3-(3,4-dimethylphenyl)propan-1-one
Description:
1-(3-bromophenyl)-3-(3,4-dimethylphenyl)propan-1-one, with the CAS number 898779-14-1, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This substance features a propanone backbone, where a bromophenyl group and a dimethylphenyl group are attached to the first and third carbon atoms, respectively. The presence of the bromine atom introduces notable electronegative characteristics, potentially influencing the compound's reactivity and solubility. The dimethyl substitution on the phenyl ring enhances steric hindrance and may affect the compound's physical properties, such as melting and boiling points. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, organic synthesis, and materials science. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could be relevant in various chemical contexts. Safety and handling considerations should be taken into account due to the presence of bromine and the compound's potential biological activity.
Formula:C17H17BrO
InChI:InChI=1/C17H17BrO/c1-12-6-7-14(10-13(12)2)8-9-17(19)15-4-3-5-16(18)11-15/h3-7,10-11H,8-9H2,1-2H3
SMILES:Cc1ccc(CCC(=O)c2cccc(c2)Br)cc1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.