CAS 898779-15-2

Methanone, (3-bromophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (3-bromophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two phenyl rings, one of which is substituted with a bromine atom. The presence of a 1,3-dioxolane ring adds to its molecular complexity, contributing to its potential reactivity and interactions. This compound is likely to exhibit properties typical of aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The bromine substituent may influence its electronic properties, potentially enhancing its reactivity in certain chemical reactions. Additionally, the dioxolane moiety may impart specific solubility characteristics and could be involved in hydrogen bonding interactions. Overall, this compound's unique structure suggests potential applications in organic synthesis, medicinal chemistry, or materials science, although specific applications would depend on further research into its properties and behavior in various chemical environments.

Formula: C₁₆H₁₃BrO₃

InChI: InChI=1S/C16H13BrO3/c17-14-6-2-4-12(10-14)15(18)11-3-1-5-13(9-11)16-19-7-8-20-16/h1-6,9-10,16H,7-8H2

InChI key: InChIKey=JPXZKUVFJZRQNK-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(Br)=CC=C3

Synonyms:

• (3-Bromophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• 3-Bromo-3′-(1,3-dioxolan-2-yl)benzophenone
• Methanone, (3-bromophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

3-bromo-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898779-15-2

Purity: 97.0%

Molecular weight: 333.1809997558594

Ref: 10-F206807