CAS 898779-17-4
:1-Propanone, 1-(4-bromophenyl)-3-(3,4-dimethylphenyl)-
Description:
1-Propanone, 1-(4-bromophenyl)-3-(3,4-dimethylphenyl)-, also known by its CAS number 898779-17-4, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a bromophenyl group and a dimethylphenyl group. The presence of the bromine atom introduces notable electrophilic characteristics, potentially influencing its reactivity and interactions in various chemical environments. The dimethyl groups on the phenyl ring enhance steric hindrance, which can affect the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. Generally, compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could be relevant in materials science and organic electronics. Overall, this compound's unique structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C17H17BrO
InChI:InChI=1S/C17H17BrO/c1-12-3-4-14(11-13(12)2)5-10-17(19)15-6-8-16(18)9-7-15/h3-4,6-9,11H,5,10H2,1-2H3
InChI key:InChIKey=SMNMKERDPWLJNI-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(Br)C=C1)C2=CC(C)=C(C)C=C2
Synonyms:- 1-Propanone, 1-(4-bromophenyl)-3-(3,4-dimethylphenyl)-
- 4′-Bromo-3-(3,4-dimethylphenyl)propiophenone
- 1-(4-Bromophenyl)-3-(3,4-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.