CAS 898779-18-5

(4-bromophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

(4-bromophenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898779-18-5, is an organic compound characterized by its complex structure that includes a brominated phenyl group and a dioxolane moiety. This compound typically exhibits properties common to aromatic ketones, such as a relatively high melting point and solubility in organic solvents like dichloromethane and ethanol. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The dioxolane ring contributes to its stability and may influence its interaction with biological systems, suggesting potential applications in medicinal chemistry. Additionally, the compound's unique structure may impart specific optical properties, making it of interest in materials science and organic electronics. Overall, its characteristics make it a valuable compound for research and development in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₆H₁₃BrO₃

InChI: InChI=1/C16H13BrO3/c17-14-6-4-11(5-7-14)15(18)12-2-1-3-13(10-12)16-19-8-9-20-16/h1-7,10,16H,8-9H2

SMILES: c1cc(cc(c1)C1OCCO1)C(=O)c1ccc(cc1)Br

4'-bromo-3-(1,3-dioxolan-2-yl)benzophenone

CAS: 898779-18-5

Purity: 97.0%

Molecular weight: 333.1809997558594

Ref: 10-F206808