CAS 898779-23-2
:1-Propanone, 1-(4-chlorophenyl)-3-(3,4-dimethylphenyl)-
Description:
1-Propanone, 1-(4-chlorophenyl)-3-(3,4-dimethylphenyl)-, also known by its CAS number 898779-23-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 3,4-dimethylphenyl group. The presence of the chlorinated aromatic ring contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can affect their behavior in biological systems and their environmental persistence. The compound may also demonstrate interesting chemical reactivity, making it a candidate for various synthetic applications in organic chemistry. Safety data should be consulted for handling, as chlorinated compounds can pose health risks. Overall, this compound's unique structure suggests potential utility in pharmaceuticals or as an intermediate in chemical synthesis.
Formula:C17H17ClO
InChI:InChI=1S/C17H17ClO/c1-12-3-4-14(11-13(12)2)5-10-17(19)15-6-8-16(18)9-7-15/h3-4,6-9,11H,5,10H2,1-2H3
InChI key:InChIKey=MRBLVBBVECNFIY-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC=C(Cl)C=C1)C2=CC(C)=C(C)C=C2
Synonyms:- 4′-Chloro-3-(3,4-dimethylphenyl)propiophenone
- 1-(4-Chlorophenyl)-3-(3,4-dimethylphenyl)-1-propanone
- 1-Propanone, 1-(4-chlorophenyl)-3-(3,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.