CAS 898779-24-3

[3-(1,3-dioxolan-2-yl)phenyl]-(3-fluorophenyl)methanone

Description:

The chemical substance known as [3-(1,3-dioxolan-2-yl)phenyl]-(3-fluorophenyl)methanone, with the CAS number 898779-24-3, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a dioxolane moiety and a fluorophenyl group. This compound typically exhibits properties associated with ketones, including potential reactivity in nucleophilic addition reactions due to the carbonyl group. The presence of the dioxolane ring may impart unique solubility characteristics and influence the compound's overall polarity. Additionally, the fluorine atom in the 3-position of the phenyl ring can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications can be influenced by these structural features, making it a candidate for further research in various fields, including pharmaceuticals and materials science.

Formula: C₁₆H₁₃FO₃

InChI: InChI=1/C16H13FO3/c17-14-6-2-4-12(10-14)15(18)11-3-1-5-13(9-11)16-19-7-8-20-16/h1-6,9-10,16H,7-8H2

SMILES: c1cc(cc(c1)C1OCCO1)C(=O)c1cccc(c1)F

3-(1,3-dioxolan-2-yl)-3'-fluorobenzophenone

CAS: 898779-24-3

Purity: 97.0%

Molecular weight: 272.2749938964844

Ref: 10-F206811