CAS 898779-26-5

1-Propanone, 3-(3,4-dimethylphenyl)-1-(3-fluorophenyl)-

Description:

1-Propanone, 3-(3,4-dimethylphenyl)-1-(3-fluorophenyl)-, also known by its CAS number 898779-26-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,4-dimethylphenyl group and a 3-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in polarity and reactivity. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic rings, while the fluorine atom may influence its electronic properties and reactivity. Additionally, the presence of methyl groups can affect steric hindrance and overall molecular stability. As with many organic compounds, its behavior in chemical reactions can be influenced by the specific conditions, such as temperature and the presence of catalysts. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-6-7-14(10-13(12)2)8-9-17(19)15-4-3-5-16(18)11-15/h3-7,10-11H,8-9H2,1-2H3

InChI key: InChIKey=DNJWTKPPBNXXKY-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=C(C)C=C1)(=O)C2=CC(F)=CC=C2

Synonyms:

• 3-(3,4-Dimethylphenyl)-1-(3-fluorophenyl)-1-propanone
• 1-Propanone, 3-(3,4-dimethylphenyl)-1-(3-fluorophenyl)-