CAS 898779-27-6

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](4-fluorophenyl)-

Description:

Methanone, [3-(1,3-dioxolan-2-yl)phenyl](4-fluorophenyl)-, also known by its CAS number 898779-27-6, is an organic compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with a fluorine atom. The presence of the 1,3-dioxolane moiety contributes to its potential reactivity and solubility properties, as dioxolanes are known for their ability to participate in various chemical reactions, including nucleophilic attacks and ring-opening reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical applications. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluorine substituent, which can affect the compound's overall polarity and reactivity. Additionally, the compound's stability and behavior in different solvents can vary, impacting its utility in synthetic chemistry and potential applications in drug development or material science. Overall, the unique combination of functional groups in this compound makes it a subject of interest in both academic and industrial research.

Formula: C₁₆H₁₃FO₃

InChI: InChI=1S/C16H13FO3/c17-14-6-4-11(5-7-14)15(18)12-2-1-3-13(10-12)16-19-8-9-20-16/h1-7,10,16H,8-9H2

InChI key: InChIKey=YTFUXEKOZLLXJE-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC=C(F)C=C3

Synonyms:

• Methanone, [3-(1,3-dioxolan-2-yl)phenyl](4-fluorophenyl)-
• [3-(1,3-Dioxolan-2-yl)phenyl](4-fluorophenyl)methanone
• 3-(1,3-Dioxolan-2-yl)-4′-fluorobenzophenone
• 2-[3-(4-Fluorobenzoyl)phenyl]-1,3-dioxolane