CAS 898779-30-1

(2,3-dimethylphenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone

Description:

The chemical substance known as (2,3-dimethylphenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone, with the CAS number 898779-30-1, is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a phenyl group that is further substituted with a 1,3-dioxolane ring, contributing to its unique chemical properties. The presence of the dioxolane moiety suggests potential for reactivity in various chemical transformations, particularly in nucleophilic substitutions or cycloadditions. The compound's molecular structure may impart specific physical properties such as solubility in organic solvents and potential applications in materials science or pharmaceuticals. Additionally, the presence of multiple functional groups can influence its reactivity, stability, and interaction with biological systems, making it a subject of interest in synthetic organic chemistry and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.

Formula: C₁₈H₁₈O₃

InChI: InChI=1/C18H18O3/c1-12-5-3-8-16(13(12)2)17(19)14-6-4-7-15(11-14)18-20-9-10-21-18/h3-8,11,18H,9-10H2,1-2H3

SMILES: Cc1cccc(c1C)C(=O)c1cccc(c1)C1OCCO1