CAS 898779-31-2
:(3,5-dimethylphenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
Description:
The chemical substance known as (3,5-dimethylphenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898779-31-2, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with two methyl groups and a thienyl moiety linked to a dioxolane ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The dioxolane ring contributes to its polar characteristics, which can influence solubility in various solvents. Additionally, the presence of the thienyl group may impart unique electronic properties, making it of interest in fields such as organic electronics or pharmaceuticals. The compound's synthesis and reactivity can be influenced by the steric and electronic effects of the substituents, which may also affect its biological activity. Overall, this compound represents a class of molecules that could have applications in material science and medicinal chemistry.
Formula:C16H16O3S
InChI:InChI=1/C16H16O3S/c1-10-7-11(2)9-12(8-10)15(17)13-3-4-14(20-13)16-18-5-6-19-16/h3-4,7-9,16H,5-6H2,1-2H3
SMILES:Cc1cc(C)cc(c1)C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.