CAS 898779-32-3
:1-Propanone, 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-
Description:
1-Propanone, 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-, also known by its CAS number 898779-32-3, is an organic compound characterized by its ketone functional group, which features a carbonyl group (C=O) bonded to two distinct aromatic rings. This compound exhibits a relatively complex structure due to the presence of multiple methyl substituents on the phenyl rings, which can influence its physical and chemical properties, such as solubility, boiling point, and reactivity. Typically, compounds of this nature are used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or other fine chemicals. The presence of the dimethylphenyl groups suggests potential applications in materials science or as precursors in the synthesis of more complex organic molecules. Additionally, the steric hindrance introduced by the methyl groups can affect the compound's reactivity and interaction with other chemical species. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-8-9-17(12-15(13)3)10-11-19(20)18-7-5-6-14(2)16(18)4/h5-9,12H,10-11H2,1-4H3
InChI key:InChIKey=YAHISIFZAOUZIO-UHFFFAOYSA-N
SMILES:C(CCC1=CC(C)=C(C)C=C1)(=O)C2=C(C)C(C)=CC=C2
Synonyms:- 1-(2,3-Dimethylphenyl)-3-(3,4-dimethylphenyl)-1-propanone
- 2′,3′-Dimethyl-3-(3,4-dimethylphenyl)propiophenone
- 1-Propanone, 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.