CAS 898779-33-4

Methanone, (2,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (2,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,4-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and solubility. The 1,3-dioxolane moiety introduces a cyclic ether component, which can enhance the compound's stability and may also affect its interaction with biological systems. This compound is likely to exhibit moderate to low polarity due to the combination of aromatic and ether functionalities. Its unique structure suggests potential applications in pharmaceuticals or materials science, where such compounds can serve as intermediates or active ingredients. Additionally, the presence of multiple functional groups may allow for diverse chemical reactivity, making it a subject of interest in synthetic organic chemistry.

Formula: C₁₈H₁₈O₃

InChI: InChI=1S/C18H18O3/c1-12-6-7-16(13(2)10-12)17(19)14-4-3-5-15(11-14)18-20-8-9-21-18/h3-7,10-11,18H,8-9H2,1-2H3

InChI key: InChIKey=UGXTXQYYLWQYJC-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=C(C)C=C(C)C=C3

Synonyms:

• Methanone, (2,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
• (2,4-Dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone