CAS 898779-35-6
:1-(2,4-dimethylphenyl)-3-(3,4-dimethylphenyl)propan-1-one
Description:
1-(2,4-Dimethylphenyl)-3-(3,4-dimethylphenyl)propan-1-one, identified by its CAS number 898779-35-6, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents, specifically dimethylphenyl groups, which contribute to its chemical properties. This compound is typically characterized by its relatively high molecular weight and lipophilicity due to the presence of multiple methyl groups on the phenyl rings. It may exhibit properties such as moderate volatility and solubility in organic solvents, making it useful in various applications, including as an intermediate in organic synthesis or in the production of fragrances and flavoring agents. Additionally, the presence of multiple methyl groups can influence its reactivity and stability, potentially affecting its behavior in chemical reactions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-5-9-18(16(4)11-13)19(20)10-8-17-7-6-14(2)15(3)12-17/h5-7,9,11-12H,8,10H2,1-4H3
SMILES:Cc1ccc(c(C)c1)C(=O)CCc1ccc(C)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.