CAS 898779-36-7

Methanone, (2,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic character and potential for various interactions. The 1,3-dioxolane moiety introduces a cyclic ether structure, which can enhance solubility in polar solvents and may influence the compound's reactivity and stability. This compound is likely to exhibit properties typical of ketones, such as being a potential electrophile in chemical reactions. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Overall, the combination of aromatic and heterocyclic components suggests that this compound could have applications in pharmaceuticals or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₈H₁₈O₃

InChI: InChI=1S/C18H18O3/c1-12-6-7-13(2)16(10-12)17(19)14-4-3-5-15(11-14)18-20-8-9-21-18/h3-7,10-11,18H,8-9H2,1-2H3

InChI key: InChIKey=ABQKZTOKCOEWRW-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=C(C)C=CC(C)=C3

Synonyms:

• 2,5-Dimethyl-3′-(1,3-dioxolan-2-yl)benzophenone
• (2,5-Dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• Methanone, (2,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-