CymitQuimica logo

CAS 898779-37-8

:

1-(2-Pyridinyl)-1-octanone

Description:
1-(2-Pyridinyl)-1-octanone, with the CAS number 898779-37-8, is an organic compound characterized by its structure, which includes a pyridine ring and an octanone chain. This compound typically exhibits a polar nature due to the presence of the pyridine nitrogen, which can participate in hydrogen bonding, while the octanone portion contributes to its hydrophobic characteristics. As a ketone, it features a carbonyl group (C=O) that is reactive and can undergo various chemical reactions, such as nucleophilic addition. The presence of the pyridine moiety may impart biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its molecular structure suggests potential applications in organic synthesis and as a building block for more complex molecules. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular weight and the interactions between its functional groups. Overall, 1-(2-Pyridinyl)-1-octanone is a versatile compound with potential applications in various fields of chemistry.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-2-3-4-5-6-10-13(15)12-9-7-8-11-14-12/h7-9,11H,2-6,10H2,1H3
InChI key:InChIKey=VGFPXTCFKYJHMO-UHFFFAOYSA-N
SMILES:C(CCCCCCC)(=O)C1=CC=CC=N1
Synonyms:
  • 1-Octanone, 1-(2-pyridinyl)-
  • 1-(2-Pyridinyl)-1-octanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.