CAS 898779-38-9
:1-(2,5-dimethylphenyl)-3-(3,4-dimethylphenyl)propan-1-one
Description:
1-(2,5-Dimethylphenyl)-3-(3,4-dimethylphenyl)propan-1-one, with the CAS number 898779-38-9, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic rings, specifically dimethylphenyl groups, which contribute to its unique chemical properties. This compound is typically characterized by its relatively high molecular weight and moderate polarity due to the presence of the carbonyl functional group. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or fine chemicals. The presence of multiple methyl groups on the phenyl rings enhances its hydrophobic character, potentially influencing its solubility in organic solvents. Additionally, this compound may exhibit interesting photochemical properties, making it relevant in materials science and photoinitiator applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-5-6-15(3)18(11-13)19(20)10-9-17-8-7-14(2)16(4)12-17/h5-8,11-12H,9-10H2,1-4H3
SMILES:Cc1ccc(C)c(c1)C(=O)CCc1ccc(C)c(C)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.