CymitQuimica logo

CAS 898779-40-3

:

1-(2-Pyridinyl)-1-decanone

Description:
1-(2-Pyridinyl)-1-decanone, with the CAS number 898779-40-3, is an organic compound characterized by its structure, which features a decanone backbone with a pyridine ring substituent. This compound typically exhibits a moderate molecular weight and is classified as a ketone due to the presence of the carbonyl group (C=O) within its structure. The pyridine ring contributes to its aromatic properties, potentially influencing its reactivity and solubility in various solvents. Generally, compounds like 1-(2-Pyridinyl)-1-decanone may display biological activity, making them of interest in pharmaceutical and agrochemical research. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of both aliphatic and aromatic components in its structure may lead to unique interactions in chemical reactions, including potential applications in synthesis and material science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C15H23NO
InChI:InChI=1S/C15H23NO/c1-2-3-4-5-6-7-8-12-15(17)14-11-9-10-13-16-14/h9-11,13H,2-8,12H2,1H3
InChI key:InChIKey=CYSGXUQRIQAJNP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)(=O)C1=CC=CC=N1
Synonyms:
  • 1-(2-Pyridinyl)-1-decanone
  • 1-Decanone, 1-(2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.