CAS 898779-42-5

Methanone, (3,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its reactivity and physical properties. Additionally, the incorporation of a 1,3-dioxolane moiety suggests that the compound may exhibit unique chemical behavior due to the cyclic ether structure, which can participate in various chemical reactions, including nucleophilic attacks. This compound may be of interest in fields such as medicinal chemistry or materials science, where the specific arrangement of functional groups can affect biological activity or material properties. Its molecular interactions, solubility, and stability would be influenced by the substituents and the overall molecular geometry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₈O₃

InChI: InChI=1S/C18H18O3/c1-12-6-7-15(10-13(12)2)17(19)14-4-3-5-16(11-14)18-20-8-9-21-18/h3-7,10-11,18H,8-9H2,1-2H3

InChI key: InChIKey=IVCASLJSDKVYDY-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(C)=C(C)C=C3

Synonyms:

• 3,4-Dimethyl-3′-(1,3-dioxolan-2-yl)benzophenone
• Methanone, (3,4-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

3,4-dimethyl-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898779-42-5

Purity: 97.0%

Molecular weight: 282.3389892578125

Ref: 10-F206817