CAS 898779-44-7

1,3-bis(3,4-dimethylphenyl)propan-1-one

Description:

1,3-bis(3,4-dimethylphenyl)propan-1-one, also known by its CAS number 898779-44-7, is an organic compound characterized by its structure, which features a propanone backbone with two 3,4-dimethylphenyl groups attached to the first and third carbon atoms. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and as a photoinitiator in polymer chemistry. Its molecular structure contributes to its properties, including its melting point, solubility, and reactivity. The presence of the dimethylphenyl groups enhances its stability and may influence its electronic properties, making it useful in various chemical reactions. Additionally, due to its aromatic nature, it may exhibit interesting photophysical properties, which can be exploited in materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₉H₂₂O

InChI: InChI=1/C19H22O/c1-13-5-7-17(11-15(13)3)8-10-19(20)18-9-6-14(2)16(4)12-18/h5-7,9,11-12H,8,10H2,1-4H3

SMILES: Cc1ccc(CCC(=O)c2ccc(C)c(C)c2)cc1C