CAS 898779-45-8

Methanone, (3,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (3,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the 3,5-dimethylphenyl group indicates that the compound has two methyl substituents on the phenyl ring, contributing to its hydrophobic character and potentially influencing its reactivity and solubility. The second phenyl ring is substituted with a 1,3-dioxolane moiety, a five-membered cyclic ether that can enhance the compound's stability and solubility in polar solvents. This compound may exhibit interesting chemical properties, including potential applications in organic synthesis or as a building block in pharmaceuticals due to its unique structural features. Additionally, the presence of both aromatic and heterocyclic components suggests that it could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, making it a versatile compound in organic chemistry.

Formula: C₁₈H₁₈O₃

InChI: InChI=1S/C18H18O3/c1-12-8-13(2)10-16(9-12)17(19)14-4-3-5-15(11-14)18-20-6-7-21-18/h3-5,8-11,18H,6-7H2,1-2H3

InChI key: InChIKey=WLSCCRKZVZVLDS-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(C)=CC(C)=C3

Synonyms:

• Methanone, (3,5-dimethylphenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
• 3,5-Dimethyl-3′-(1,3-dioxolan-2-yl)benzophenone

3,5-dimethyl-3'-(1,3-dioxolan-2-yl)benzophenone

CAS: 898779-45-8

Purity: 97.0%

Molecular weight: 282.3389892578125

Ref: 10-F206818