CAS 898779-48-1

Methanone, (4-bromo-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:

Methanone, (4-bromo-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings introduces unique electronic properties, potentially influencing its reactivity and interactions in chemical processes. The 1,3-dioxolane moiety contributes to the compound's stability and solubility characteristics, making it relevant in various chemical applications. This compound may exhibit interesting biological activities due to its structural features, which can affect its pharmacokinetics and mechanism of action. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. Overall, Methanone, (4-bromo-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- represents a class of compounds that may be of interest in medicinal chemistry and material science.

Formula: C₁₆H₁₂BrFO₃

InChI: InChI=1S/C16H12BrFO3/c17-13-5-4-11(9-14(13)18)15(19)10-2-1-3-12(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2

InChI key: InChIKey=GTSUCDRNQGSBRX-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(F)=C(Br)C=C3

Synonyms:

• Methanone, (4-bromo-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
• (4-Bromo-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
• 4-Bromo-3′-(1,3-dioxolan-2-yl)-3-fluorobenzophenone