CAS 898779-50-5

1-(4-bromo-3-fluoro-phenyl)-3-(3,4-dimethylphenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(3,4-dimethylphenyl)propan-1-one, with the CAS number 898779-50-5, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a phenyl ring substituted with both a bromine and a fluorine atom, contributing to its unique electronic properties and potential reactivity. The presence of the 3,4-dimethylphenyl group enhances its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. The bromine and fluorine substituents can also affect the compound's stability and reactivity, making it of interest in various chemical applications, including medicinal chemistry and material science. As a ketone, it may participate in typical reactions associated with carbonyl compounds, such as nucleophilic addition. The specific arrangement of substituents suggests potential for diverse biological activity, warranting further investigation into its pharmacological properties. Overall, this compound exemplifies the intricate interplay of functional groups in determining the behavior and utility of organic molecules in chemical research.

Formula: C₁₇H₁₆BrFO

InChI: InChI=1/C17H16BrFO/c1-11-3-4-13(9-12(11)2)5-8-17(20)14-6-7-15(18)16(19)10-14/h3-4,6-7,9-10H,5,8H2,1-2H3

SMILES: Cc1ccc(CCC(=O)c2ccc(c(c2)F)Br)cc1C

4′-bromo-3-(3,4-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898779-50-5

Formula: C₁₇H₁₆BrFO

Purity: 97.0%

Molecular weight: 335.216

Ref: 10-F206598