CymitQuimica logo

CAS 898779-51-6

:

Methanone, (4-chloro-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-

Description:
Methanone, (4-chloro-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 4-chloro and a 3-fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and interactions with biological systems. The inclusion of a 1,3-dioxolane moiety suggests that the compound may exhibit interesting solubility and stability characteristics, as dioxolanes are known for their ether-like properties. This compound may be of interest in medicinal chemistry due to its potential biological activity, as halogenated phenyl groups often play a role in enhancing the pharmacological profile of drug candidates. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile scaffold for synthetic chemistry. Overall, the compound's structural features suggest it may have applications in various fields, including pharmaceuticals and materials science.
Formula:C16H12ClFO3
InChI:InChI=1S/C16H12ClFO3/c17-13-5-4-11(9-14(13)18)15(19)10-2-1-3-12(8-10)16-20-6-7-21-16/h1-5,8-9,16H,6-7H2
InChI key:InChIKey=BXSDFIJIDONTKP-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C=CC1)C2OCCO2)C3=CC(F)=C(Cl)C=C3
Synonyms:
  • Methanone, (4-chloro-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]-
  • (4-Chloro-3-fluorophenyl)[3-(1,3-dioxolan-2-yl)phenyl]methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.