CAS 898779-53-8

1-(4-chloro-3-fluoro-phenyl)-3-(3,4-dimethylphenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(3,4-dimethylphenyl)propan-1-one, identified by its CAS number 898779-53-8, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring, and a dimethyl-substituted phenyl group on the other. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is likely to be soluble in organic solvents due to its hydrophobic aromatic components. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity, making it potentially useful in various chemical syntheses or as an intermediate in pharmaceutical development. Additionally, the specific arrangement of substituents may impart unique biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-3-4-13(9-12(11)2)5-8-17(20)14-6-7-15(18)16(19)10-14/h3-4,6-7,9-10H,5,8H2,1-2H3

SMILES: Cc1ccc(CCC(=O)c2ccc(c(c2)F)Cl)cc1C