CAS 898779-54-9
:Cycloheptyl-2-pyridinylmethanone
Description:
Cycloheptyl-2-pyridinylmethanone is an organic compound characterized by its unique structure, which includes a cycloheptyl group and a pyridine ring. This compound typically exhibits properties associated with both cyclic and aromatic systems, contributing to its stability and reactivity. The presence of the carbonyl group (ketone) in its structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Cycloheptyl-2-pyridinylmethanone may also display moderate polarity due to the electronegative nitrogen in the pyridine ring, influencing its solubility in organic solvents. Additionally, the compound's molecular framework may impart specific biological activities, making it of interest in medicinal chemistry. Its potential applications could extend to pharmaceuticals or agrochemicals, depending on its biological interactions. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c15-13(12-9-5-6-10-14-12)11-7-3-1-2-4-8-11/h5-6,9-11H,1-4,7-8H2
InChI key:InChIKey=QGODLSVSGWYWPJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=CC=N1)C2CCCCCC2
Synonyms:- Cycloheptyl(pyridin-2-yl)methanone
- Cycloheptyl-2-pyridinylmethanone
- Methanone, Cycloheptyl-2-Pyridinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.