CAS 898779-57-2

1-Propanone, 1-(2-chlorophenyl)-3-(3,4-dimethylphenyl)-

Description:

1-Propanone, 1-(2-chlorophenyl)-3-(3,4-dimethylphenyl)-, also known by its CAS number 898779-57-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2-chlorophenyl group and a 3,4-dimethylphenyl group. The presence of the chlorine atom introduces a degree of polarity, which can influence its solubility and reactivity. The dimethyl substitution on the phenyl ring contributes to steric hindrance, potentially affecting its chemical behavior and interactions. Typically, compounds of this nature exhibit moderate volatility and can be soluble in organic solvents while being less soluble in water due to their hydrophobic aromatic components. The compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features that could impart specific biological or chemical properties. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₁₇H₁₇ClO

InChI: InChI=1S/C17H17ClO/c1-12-7-8-14(11-13(12)2)9-10-17(19)15-5-3-4-6-16(15)18/h3-8,11H,9-10H2,1-2H3

InChI key: InChIKey=QBQDOILJJGCNLK-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=C(C)C=C1)(=O)C2=C(Cl)C=CC=C2

Synonyms:

• 1-Propanone, 1-(2-chlorophenyl)-3-(3,4-dimethylphenyl)-
• 2′-Chloro-3-(3,4-dimethylphenyl)propiophenone

2′-chloro-3-(3,4-dimethylphenyl)propiophenone

CAS: 898779-57-2

Formula: C₁₇H₁₇ClO

Purity: 97.0%

Molecular weight: 272.77

Ref: 10-F206601