CAS 898779-59-4

3-(3,4-dimethylphenyl)-1-(2-fluorophenyl)propan-1-one

Description:

3-(3,4-Dimethylphenyl)-1-(2-fluorophenyl)propan-1-one, with the CAS number 898779-59-4, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two distinct aromatic groups: a 3,4-dimethylphenyl group and a 2-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including its potential reactivity and solubility characteristics. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological systems. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could lead to specific biological activities or applications. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied or utilized. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₇H₁₇FO

InChI: InChI=1/C17H17FO/c1-12-7-8-14(11-13(12)2)9-10-17(19)15-5-3-4-6-16(15)18/h3-8,11H,9-10H2,1-2H3

SMILES: Cc1ccc(CCC(=O)c2ccccc2F)cc1C